C13H18Cl3NO5 — CID 11760551
[(1R,2S,4R)-2-acetyloxy-4-methyl-4-[(2,2,2-trichloroacetyl)amino]cyclohexyl] acetate (PubChem CID 11760551) has the molecular formula C13H18Cl3NO5 and a molecular weight of 374.65 g/mol. Its IUPAC name is [(1R,2S,4R)-2-acetyloxy-4-methyl-4-[(2,2,2-trichloroacetyl)amino]cyclohexyl] acetate.
| Compound Name | [(1R,2S,4R)-2-acetyloxy-4-methyl-4-[(2,2,2-trichloroacetyl)amino]cyclohexyl] acetate |
|---|---|
| PubChem CID | 11760551 |
| Molecular Formula | C13H18Cl3NO5 |
| Molecular Weight | 374.65 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | [(1R,2S,4R)-2-acetyloxy-4-methyl-4-[(2,2,2-trichloroacetyl)amino]cyclohexyl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@](C)(NC(=O)C(Cl)(Cl)Cl)CC[C@H]1OC(C)=O |
| InChI | InChI=1S/C13H18Cl3NO5/c1-7(18)21-9-4-5-12(3,6-10(9)22-8(2)19)17-11(20)13(14,15)16/h9-10H,4-6H2,1-3H3,(H,17,20)/t9-,10+,12-/m1/s1 |
| InChIKey | ZNCYCGUZUONNDO-JFGNBEQYSA-N |
| XLogP | 2.28 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.65 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|