C20H30O9S — CID 13013140
(2,6,9-triacetyloxy-13-oxo-13lambda4-thiabicyclo[8.2.1]tridecan-5-yl) acetate (PubChem CID 13013140) has the molecular formula C20H30O9S and a molecular weight of 446.52 g/mol. Its IUPAC name is (2,6,9-triacetyloxy-13-oxo-13lambda4-thiabicyclo[8.2.1]tridecan-5-yl) acetate.
| Compound Name | (2,6,9-triacetyloxy-13-oxo-13lambda4-thiabicyclo[8.2.1]tridecan-5-yl) acetate |
|---|---|
| PubChem CID | 13013140 |
| Molecular Formula | C20H30O9S |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | (2,6,9-triacetyloxy-13-oxo-13lambda4-thiabicyclo[8.2.1]tridecan-5-yl) acetate |
| SMILES | CC(=O)OC1CCC(OC(C)=O)C2CCC(C(OC(C)=O)CCC1OC(C)=O)S2=O |
| InChI | InChI=1S/C20H30O9S/c1-11(21)26-15-5-7-17(28-13(3)23)19-9-10-20(30(19)25)18(29-14(4)24)8-6-16(15)27-12(2)22/h15-20H,5-10H2,1-4H3 |
| InChIKey | VJONREWWCWJHGC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|