C9H13Cl2FO2S — CID 134988474
[(1R,2R)-2-[dichloro(fluoro)methyl]sulfanylcyclohexyl] acetate (PubChem CID 134988474) has the molecular formula C9H13Cl2FO2S and a molecular weight of 275.17 g/mol. Its IUPAC name is [(1R,2R)-2-[dichloro(fluoro)methyl]sulfanylcyclohexyl] acetate.
| Compound Name | [(1R,2R)-2-[dichloro(fluoro)methyl]sulfanylcyclohexyl] acetate |
|---|---|
| PubChem CID | 134988474 |
| Molecular Formula | C9H13Cl2FO2S |
| Molecular Weight | 275.17 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | [(1R,2R)-2-[dichloro(fluoro)methyl]sulfanylcyclohexyl] acetate |
| SMILES | CC(=O)O[C@@H]1CCCC[C@H]1SC(F)(Cl)Cl |
| InChI | InChI=1S/C9H13Cl2FO2S/c1-6(13)14-7-4-2-3-5-8(7)15-9(10,11)12/h7-8H,2-5H2,1H3/t7-,8-/m1/s1 |
| InChIKey | JFIJKQULEXTUIV-HTQZYQBOSA-N |
| XLogP | 3.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.17 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|