C15H22BrClO2 — CID 46881080
(2S)-2-[(1R,3R,4R)-3-bromo-4-chloro-4-methylcyclohexyl]-2,6,6-trimethylpyran-3-one (PubChem CID 46881080) has the molecular formula C15H22BrClO2 and a molecular weight of 349.70 g/mol. Its IUPAC name is (2S)-2-[(1R,3R,4R)-3-bromo-4-chloro-4-methylcyclohexyl]-2,6,6-trimethylpyran-3-one.
| Compound Name | (2S)-2-[(1R,3R,4R)-3-bromo-4-chloro-4-methylcyclohexyl]-2,6,6-trimethylpyran-3-one |
|---|---|
| PubChem CID | 46881080 |
| Molecular Formula | C15H22BrClO2 |
| Molecular Weight | 349.70 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | (2S)-2-[(1R,3R,4R)-3-bromo-4-chloro-4-methylcyclohexyl]-2,6,6-trimethylpyran-3-one |
| SMILES | CC1(C)C=CC(=O)[C@](C)([C@@H]2CC[C@@](C)(Cl)[C@H](Br)C2)O1 |
| InChI | InChI=1S/C15H22BrClO2/c1-13(2)7-6-12(18)15(4,19-13)10-5-8-14(3,17)11(16)9-10/h6-7,10-11H,5,8-9H2,1-4H3/t10-,11-,14-,15+/m1/s1 |
| InChIKey | PXPRNVNJRBIVSF-FKGLVLAHSA-N |
| XLogP | 4.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.70 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|