C13H18O2S — CID 101412136
(1'R,2S,4'S)-1',3',3'-trimethylspiro[1,3-oxathiine-2,2'-bicyclo[2.2.1]heptane]-6-one (PubChem CID 101412136) has the molecular formula C13H18O2S and a molecular weight of 238.35 g/mol. Its IUPAC name is (1'R,2S,4'S)-1',3',3'-trimethylspiro[1,3-oxathiine-2,2'-bicyclo[2.2.1]heptane]-6-one.
| Compound Name | (1'R,2S,4'S)-1',3',3'-trimethylspiro[1,3-oxathiine-2,2'-bicyclo[2.2.1]heptane]-6-one |
|---|---|
| PubChem CID | 101412136 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (1'R,2S,4'S)-1',3',3'-trimethylspiro[1,3-oxathiine-2,2'-bicyclo[2.2.1]heptane]-6-one |
| SMILES | CC1(C)[C@H]2CC[C@](C)(C2)[C@@]12OC(=O)C=CS2 |
| InChI | InChI=1S/C13H18O2S/c1-11(2)9-4-6-12(3,8-9)13(11)15-10(14)5-7-16-13/h5,7,9H,4,6,8H2,1-3H3/t9-,12+,13+/m0/s1 |
| InChIKey | IUIHSEPHBAYIPM-ZWKOPEQDSA-N |
| XLogP | 3.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |