C10H15BrCl2O — CID 163057023
(2S,3S,5R)-5-bromo-3-chloro-2-[(E)-2-chloroethenyl]-2,6,6-trimethyloxane (PubChem CID 163057023) has the molecular formula C10H15BrCl2O and a molecular weight of 302.04 g/mol. Its IUPAC name is (2S,3S,5R)-5-bromo-3-chloro-2-[(E)-2-chloroethenyl]-2,6,6-trimethyloxane.
| Compound Name | (2S,3S,5R)-5-bromo-3-chloro-2-[(E)-2-chloroethenyl]-2,6,6-trimethyloxane |
|---|---|
| PubChem CID | 163057023 |
| Molecular Formula | C10H15BrCl2O |
| Molecular Weight | 302.04 g/mol |
| Exact Mass | 299.97 |
| IUPAC Name | (2S,3S,5R)-5-bromo-3-chloro-2-[(E)-2-chloroethenyl]-2,6,6-trimethyloxane |
| SMILES | CC1(C)O[C@@](C)(/C=C/Cl)[C@@H](Cl)C[C@H]1Br |
| InChI | InChI=1S/C10H15BrCl2O/c1-9(2)7(11)6-8(13)10(3,14-9)4-5-12/h4-5,7-8H,6H2,1-3H3/b5-4+/t7-,8+,10+/m1/s1 |
| InChIKey | UZDVEPSWHCPIPM-FWWPZPIUSA-N |
| XLogP | 4.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.04 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|