C10H13BrCl2O — CID 73193676
4-bromo-3-chloro-6-(2-chloroethenyl)-1,3-dimethyl-7-oxabicyclo[4.1.0]heptane (PubChem CID 73193676) has the molecular formula C10H13BrCl2O and a molecular weight of 300.02 g/mol. Its IUPAC name is 4-bromo-3-chloro-6-(2-chloroethenyl)-1,3-dimethyl-7-oxabicyclo[4.1.0]heptane.
| Compound Name | 4-bromo-3-chloro-6-(2-chloroethenyl)-1,3-dimethyl-7-oxabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 73193676 |
| Molecular Formula | C10H13BrCl2O |
| Molecular Weight | 300.02 g/mol |
| Exact Mass | 297.95 |
| IUPAC Name | 4-bromo-3-chloro-6-(2-chloroethenyl)-1,3-dimethyl-7-oxabicyclo[4.1.0]heptane |
| SMILES | CC1(Cl)CC2(C)OC2(C=CCl)CC1Br |
| InChI | InChI=1S/C10H13BrCl2O/c1-8(13)6-9(2)10(14-9,3-4-12)5-7(8)11/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | WBXHOGVKFYXMBX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.02 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|