C17H31ClO2Si — CID 11174924
tert-butyl-[[(1R,3S,6S)-6-[(E)-2-chloroethenyl]-1,5,5-trimethyl-7-oxabicyclo[4.1.0]heptan-3-yl]oxy]-dimethylsilane (PubChem CID 11174924) has the molecular formula C17H31ClO2Si and a molecular weight of 330.97 g/mol. Its IUPAC name is tert-butyl-[[(1R,3S,6S)-6-[(E)-2-chloroethenyl]-1,5,5-trimethyl-7-oxabicyclo[4.1.0]heptan-3-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1R,3S,6S)-6-[(E)-2-chloroethenyl]-1,5,5-trimethyl-7-oxabicyclo[4.1.0]heptan-3-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 11174924 |
| Molecular Formula | C17H31ClO2Si |
| Molecular Weight | 330.97 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | tert-butyl-[[(1R,3S,6S)-6-[(E)-2-chloroethenyl]-1,5,5-trimethyl-7-oxabicyclo[4.1.0]heptan-3-yl]oxy]-dimethylsilane |
| SMILES | CC1(C)C[C@H](O[Si](C)(C)C(C)(C)C)C[C@@]2(C)O[C@@]12/C=C/Cl |
| InChI | InChI=1S/C17H31ClO2Si/c1-14(2,3)21(7,8)19-13-11-15(4,5)17(9-10-18)16(6,12-13)20-17/h9-10,13H,11-12H2,1-8H3/b10-9+/t13-,16+,17-/m0/s1 |
| InChIKey | CVPQGGJBHAIBIX-RYCAGCRTSA-N |
| XLogP | 5.48 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.97 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|