C13H23NO3Si — CID 175168819
[3-[tert-butyl(dimethyl)silyl]oxy-1-ethynylcyclobutyl] carbamate (PubChem CID 175168819) has the molecular formula C13H23NO3Si and a molecular weight of 269.42 g/mol. Its IUPAC name is [3-[tert-butyl(dimethyl)silyl]oxy-1-ethynylcyclobutyl] carbamate.
| Compound Name | [3-[tert-butyl(dimethyl)silyl]oxy-1-ethynylcyclobutyl] carbamate |
|---|---|
| PubChem CID | 175168819 |
| Molecular Formula | C13H23NO3Si |
| Molecular Weight | 269.42 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | [3-[tert-butyl(dimethyl)silyl]oxy-1-ethynylcyclobutyl] carbamate |
| SMILES | C#CC1(OC(N)=O)CC(O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C13H23NO3Si/c1-7-13(16-11(14)15)8-10(9-13)17-18(5,6)12(2,3)4/h1,10H,8-9H2,2-6H3,(H2,14,15) |
| InChIKey | ZSIDGRHJMQIGKS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|