C20H38O4Si — CID 11068662
3-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl]propyl acetate (PubChem CID 11068662) has the molecular formula C20H38O4Si and a molecular weight of 370.61 g/mol. Its IUPAC name is 3-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl]propyl acetate.
| Compound Name | 3-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl]propyl acetate |
|---|---|
| PubChem CID | 11068662 |
| Molecular Formula | C20H38O4Si |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 3-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl]propyl acetate |
| SMILES | CC(=O)OCCC[C@]12OC1(C)C[C@@H](O[Si](C)(C)C(C)(C)C)CC2(C)C |
| InChI | InChI=1S/C20H38O4Si/c1-15(21)22-12-10-11-20-18(5,6)13-16(14-19(20,7)24-20)23-25(8,9)17(2,3)4/h16H,10-14H2,1-9H3/t16-,19?,20+/m0/s1 |
| InChIKey | DPLHHBRIGBIGFC-OOFVQCGSSA-N |
| XLogP | 5.07 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|