C10H13BrCl2 — CID 162891352
(4S,5R)-5-bromo-4-chloro-1-[(E)-2-chloroethenyl]-2,4-dimethylcyclohexene (PubChem CID 162891352) has the molecular formula C10H13BrCl2 and a molecular weight of 284.02 g/mol. Its IUPAC name is (4S,5R)-5-bromo-4-chloro-1-[(E)-2-chloroethenyl]-2,4-dimethylcyclohexene.
| Compound Name | (4S,5R)-5-bromo-4-chloro-1-[(E)-2-chloroethenyl]-2,4-dimethylcyclohexene |
|---|---|
| PubChem CID | 162891352 |
| Molecular Formula | C10H13BrCl2 |
| Molecular Weight | 284.02 g/mol |
| Exact Mass | 281.96 |
| IUPAC Name | (4S,5R)-5-bromo-4-chloro-1-[(E)-2-chloroethenyl]-2,4-dimethylcyclohexene |
| SMILES | CC1=C(/C=C/Cl)C[C@@H](Br)[C@@](C)(Cl)C1 |
| InChI | InChI=1S/C10H13BrCl2/c1-7-6-10(2,13)9(11)5-8(7)3-4-12/h3-4,9H,5-6H2,1-2H3/b4-3+/t9-,10+/m1/s1 |
| InChIKey | VUTYPBUUSNGOML-OKWQPMOJSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.02 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|