C15H20BrClO2 — CID 102233552
(3R,4S,6S,9Z)-4-bromo-9-(chloromethylidene)-3-hydroxy-5,5-dimethyl-1-methylidenespiro[5.5]undecan-10-one (PubChem CID 102233552) has the molecular formula C15H20BrClO2 and a molecular weight of 347.68 g/mol. Its IUPAC name is (3R,4S,6S,9Z)-4-bromo-9-(chloromethylidene)-3-hydroxy-5,5-dimethyl-1-methylidenespiro[5.5]undecan-10-one.
| Compound Name | (3R,4S,6S,9Z)-4-bromo-9-(chloromethylidene)-3-hydroxy-5,5-dimethyl-1-methylidenespiro[5.5]undecan-10-one |
|---|---|
| PubChem CID | 102233552 |
| Molecular Formula | C15H20BrClO2 |
| Molecular Weight | 347.68 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | (3R,4S,6S,9Z)-4-bromo-9-(chloromethylidene)-3-hydroxy-5,5-dimethyl-1-methylidenespiro[5.5]undecan-10-one |
| SMILES | C=C1C[C@@H](O)[C@@H](Br)C(C)(C)[C@]12CC/C(=C/Cl)C(=O)C2 |
| InChI | InChI=1S/C15H20BrClO2/c1-9-6-11(18)13(16)14(2,3)15(9)5-4-10(8-17)12(19)7-15/h8,11,13,18H,1,4-7H2,2-3H3/b10-8-/t11-,13-,15+/m1/s1 |
| InChIKey | CLTCUZKWEBWLIY-RZOCALEESA-N |
| XLogP | 3.96 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.68 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|