C15H21Br3O2 — CID 134131968
(3R,4S,6S,9S)-4-bromo-9-(dibromomethyl)-5,5-dimethyl-1-methylidenespiro[5.5]undec-10-ene-3,9-diol (PubChem CID 134131968) has the molecular formula C15H21Br3O2 and a molecular weight of 473.04 g/mol. Its IUPAC name is (3R,4S,6S,9S)-4-bromo-9-(dibromomethyl)-5,5-dimethyl-1-methylidenespiro[5.5]undec-10-ene-3,9-diol.
| Compound Name | (3R,4S,6S,9S)-4-bromo-9-(dibromomethyl)-5,5-dimethyl-1-methylidenespiro[5.5]undec-10-ene-3,9-diol |
|---|---|
| PubChem CID | 134131968 |
| Molecular Formula | C15H21Br3O2 |
| Molecular Weight | 473.04 g/mol |
| Exact Mass | 469.91 |
| IUPAC Name | (3R,4S,6S,9S)-4-bromo-9-(dibromomethyl)-5,5-dimethyl-1-methylidenespiro[5.5]undec-10-ene-3,9-diol |
| SMILES | C=C1C[C@@H](O)[C@@H](Br)C(C)(C)[C@@]12C=C[C@](O)(C(Br)Br)CC2 |
| InChI | InChI=1S/C15H21Br3O2/c1-9-8-10(19)11(16)13(2,3)14(9)4-6-15(20,7-5-14)12(17)18/h4,6,10-12,19-20H,1,5,7-8H2,2-3H3/t10-,11-,14-,15-/m1/s1 |
| InChIKey | BDUUDTPDYKKJPZ-YIKOMLBNSA-N |
| XLogP | 4.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.04 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|