C15H22BrClO2 — CID 72745630
3-bromo-4-chloro-4,12,12-trimethyl-11-methylidene-7-oxatricyclo[6.3.1.01,6]dodecan-9-ol (PubChem CID 72745630) has the molecular formula C15H22BrClO2 and a molecular weight of 349.70 g/mol. Its IUPAC name is 3-bromo-4-chloro-4,12,12-trimethyl-11-methylidene-7-oxatricyclo[6.3.1.01,6]dodecan-9-ol.
| Compound Name | 3-bromo-4-chloro-4,12,12-trimethyl-11-methylidene-7-oxatricyclo[6.3.1.01,6]dodecan-9-ol |
|---|---|
| PubChem CID | 72745630 |
| Molecular Formula | C15H22BrClO2 |
| Molecular Weight | 349.70 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 3-bromo-4-chloro-4,12,12-trimethyl-11-methylidene-7-oxatricyclo[6.3.1.01,6]dodecan-9-ol |
| SMILES | C=C1CC(O)C2OC3CC(C)(Cl)C(Br)CC13C2(C)C |
| InChI | InChI=1S/C15H22BrClO2/c1-8-5-9(18)12-13(2,3)15(8)6-10(16)14(4,17)7-11(15)19-12/h9-12,18H,1,5-7H2,2-4H3 |
| InChIKey | CVIAYTVVVURFBO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.70 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|