C15H22BrCl — CID 14680655
(6R,9R,10R)-10-bromo-9-chloro-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-3-ene (PubChem CID 14680655) has the molecular formula C15H22BrCl and a molecular weight of 317.70 g/mol. Its IUPAC name is (6R,9R,10R)-10-bromo-9-chloro-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-3-ene.
| Compound Name | (6R,9R,10R)-10-bromo-9-chloro-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-3-ene |
|---|---|
| PubChem CID | 14680655 |
| Molecular Formula | C15H22BrCl |
| Molecular Weight | 317.70 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | (6R,9R,10R)-10-bromo-9-chloro-5,5,9-trimethyl-1-methylidenespiro[5.5]undec-3-ene |
| SMILES | C=C1CC=CC(C)(C)[C@@]12CC[C@@](C)(Cl)[C@H](Br)C2 |
| InChI | InChI=1S/C15H22BrCl/c1-11-6-5-7-13(2,3)15(11)9-8-14(4,17)12(16)10-15/h5,7,12H,1,6,8-10H2,2-4H3/t12-,14-,15-/m1/s1 |
| InChIKey | MNGJZORQSGCQAN-BPLDGKMQSA-N |
| XLogP | 5.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.70 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|