C15H22BrClO — CID 162848416
(1R,3S,4S,6R,8S)-3-bromo-4-chloro-4,12,12-trimethyl-11-methylidene-7-oxatricyclo[6.3.1.01,6]dodecane (PubChem CID 162848416) has the molecular formula C15H22BrClO and a molecular weight of 333.70 g/mol. Its IUPAC name is (1R,3S,4S,6R,8S)-3-bromo-4-chloro-4,12,12-trimethyl-11-methylidene-7-oxatricyclo[6.3.1.01,6]dodecane.
| Compound Name | (1R,3S,4S,6R,8S)-3-bromo-4-chloro-4,12,12-trimethyl-11-methylidene-7-oxatricyclo[6.3.1.01,6]dodecane |
|---|---|
| PubChem CID | 162848416 |
| Molecular Formula | C15H22BrClO |
| Molecular Weight | 333.70 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | (1R,3S,4S,6R,8S)-3-bromo-4-chloro-4,12,12-trimethyl-11-methylidene-7-oxatricyclo[6.3.1.01,6]dodecane |
| SMILES | C=C1CC[C@@H]2O[C@@H]3C[C@](C)(Cl)[C@@H](Br)C[C@]13C2(C)C |
| InChI | InChI=1S/C15H22BrClO/c1-9-5-6-11-13(2,3)15(9)7-10(16)14(4,17)8-12(15)18-11/h10-12H,1,5-8H2,2-4H3/t10-,11-,12+,14-,15-/m0/s1 |
| InChIKey | LRYORSJIDYKJNR-QIRZIZBZSA-N |
| XLogP | 4.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.70 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|