C15H21Br2ClO2 — CID 163056142
(1R,3S,4S,8R,11R)-3,8-dibromo-4-chloro-4,11,12,12-tetramethyl-7-oxatricyclo[6.3.1.01,6]dodec-9-en-11-ol (PubChem CID 163056142) has the molecular formula C15H21Br2ClO2 and a molecular weight of 428.59 g/mol. Its IUPAC name is (1R,3S,4S,8R,11R)-3,8-dibromo-4-chloro-4,11,12,12-tetramethyl-7-oxatricyclo[6.3.1.01,6]dodec-9-en-11-ol.
| Compound Name | (1R,3S,4S,8R,11R)-3,8-dibromo-4-chloro-4,11,12,12-tetramethyl-7-oxatricyclo[6.3.1.01,6]dodec-9-en-11-ol |
|---|---|
| PubChem CID | 163056142 |
| Molecular Formula | C15H21Br2ClO2 |
| Molecular Weight | 428.59 g/mol |
| Exact Mass | 425.96 |
| IUPAC Name | (1R,3S,4S,8R,11R)-3,8-dibromo-4-chloro-4,11,12,12-tetramethyl-7-oxatricyclo[6.3.1.01,6]dodec-9-en-11-ol |
| SMILES | CC1(C)[C@]23C[C@H](Br)[C@@](C)(Cl)CC2O[C@@]1(Br)C=C[C@@]3(C)O |
| InChI | InChI=1S/C15H21Br2ClO2/c1-11(2)14-7-9(16)12(3,18)8-10(14)20-15(11,17)6-5-13(14,4)19/h5-6,9-10,19H,7-8H2,1-4H3/t9-,10?,12-,13+,14-,15-/m0/s1 |
| InChIKey | WNGMEQXERFPHIP-BPWAVEJKSA-N |
| XLogP | 4.36 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.59 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|