C15H23Br2ClO — CID 14165915
(3S,4S,6S)-4,10-dibromo-9-chloro-1,5,5,9-tetramethylspiro[5.5]undec-1-en-3-ol (PubChem CID 14165915) has the molecular formula C15H23Br2ClO and a molecular weight of 414.61 g/mol. Its IUPAC name is (3S,4S,6S)-4,10-dibromo-9-chloro-1,5,5,9-tetramethylspiro[5.5]undec-1-en-3-ol.
| Compound Name | (3S,4S,6S)-4,10-dibromo-9-chloro-1,5,5,9-tetramethylspiro[5.5]undec-1-en-3-ol |
|---|---|
| PubChem CID | 14165915 |
| Molecular Formula | C15H23Br2ClO |
| Molecular Weight | 414.61 g/mol |
| Exact Mass | 411.98 |
| IUPAC Name | (3S,4S,6S)-4,10-dibromo-9-chloro-1,5,5,9-tetramethylspiro[5.5]undec-1-en-3-ol |
| SMILES | CC1=C[C@H](O)[C@@H](Br)C(C)(C)[C@]12CCC(C)(Cl)C(Br)C2 |
| InChI | InChI=1S/C15H23Br2ClO/c1-9-7-10(19)12(17)13(2,3)15(9)6-5-14(4,18)11(16)8-15/h7,10-12,19H,5-6,8H2,1-4H3/t10-,11?,12+,14?,15-/m0/s1 |
| InChIKey | MUWVHMSGCVMDSW-SEOXFTARSA-N |
| XLogP | 5.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.61 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|