C15H25Br2ClO — CID 558901
4,10-dibromo-9-chloro-1,5,5,9-tetramethylspiro[5.5]undecan-3-ol (PubChem CID 558901) has the molecular formula C15H25Br2ClO and a molecular weight of 416.63 g/mol. Its IUPAC name is 4,10-dibromo-9-chloro-1,5,5,9-tetramethylspiro[5.5]undecan-3-ol.
| Compound Name | 4,10-dibromo-9-chloro-1,5,5,9-tetramethylspiro[5.5]undecan-3-ol |
|---|---|
| PubChem CID | 558901 |
| Molecular Formula | C15H25Br2ClO |
| Molecular Weight | 416.63 g/mol |
| Exact Mass | 414.00 |
| IUPAC Name | 4,10-dibromo-9-chloro-1,5,5,9-tetramethylspiro[5.5]undecan-3-ol |
| SMILES | CC1CC(O)C(Br)C(C)(C)C12CCC(C)(Cl)C(Br)C2 |
| InChI | InChI=1S/C15H25Br2ClO/c1-9-7-10(19)12(17)13(2,3)15(9)6-5-14(4,18)11(16)8-15/h9-12,19H,5-8H2,1-4H3 |
| InChIKey | IDWIUXHNQBVESY-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.63 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|