C16H24BrClO2 — CID 162800914
3-bromo-4-chloro-4,13,14,14-tetramethyl-7,12-dioxatetracyclo[7.4.1.01,6.011,13]tetradecane (PubChem CID 162800914) has the molecular formula C16H24BrClO2 and a molecular weight of 363.72 g/mol. Its IUPAC name is 3-bromo-4-chloro-4,13,14,14-tetramethyl-7,12-dioxatetracyclo[7.4.1.01,6.011,13]tetradecane.
| Compound Name | 3-bromo-4-chloro-4,13,14,14-tetramethyl-7,12-dioxatetracyclo[7.4.1.01,6.011,13]tetradecane |
|---|---|
| PubChem CID | 162800914 |
| Molecular Formula | C16H24BrClO2 |
| Molecular Weight | 363.72 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 3-bromo-4-chloro-4,13,14,14-tetramethyl-7,12-dioxatetracyclo[7.4.1.01,6.011,13]tetradecane |
| SMILES | CC1(Cl)CC2OCC3CC4OC4(C)C2(CC1Br)C3(C)C |
| InChI | InChI=1S/C16H24BrClO2/c1-13(2)9-5-11-15(4,20-11)16(13)6-10(17)14(3,18)7-12(16)19-8-9/h9-12H,5-8H2,1-4H3 |
| InChIKey | JKOIMVRTLOYHBH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.72 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|