C15H25BrO2 — CID 76548710
4-bromo-5,5,9-trimethyl-1-methylidenespiro[5.5]undecane-9,10-diol (PubChem CID 76548710) has the molecular formula C15H25BrO2 and a molecular weight of 317.27 g/mol. Its IUPAC name is 4-bromo-5,5,9-trimethyl-1-methylidenespiro[5.5]undecane-9,10-diol.
| Compound Name | 4-bromo-5,5,9-trimethyl-1-methylidenespiro[5.5]undecane-9,10-diol |
|---|---|
| PubChem CID | 76548710 |
| Molecular Formula | C15H25BrO2 |
| Molecular Weight | 317.27 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 4-bromo-5,5,9-trimethyl-1-methylidenespiro[5.5]undecane-9,10-diol |
| SMILES | C=C1CCC(Br)C(C)(C)C12CCC(C)(O)C(O)C2 |
| InChI | InChI=1S/C15H25BrO2/c1-10-5-6-11(16)13(2,3)15(10)8-7-14(4,18)12(17)9-15/h11-12,17-18H,1,5-9H2,2-4H3 |
| InChIKey | FRWZPOWVSVGUBL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.27 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|