C9H13BrO — CID 132551745
(4R)-4-bromo-3,3-dimethyl-2-methylidenecyclohexan-1-one (PubChem CID 132551745) has the molecular formula C9H13BrO and a molecular weight of 217.11 g/mol. Its IUPAC name is (4R)-4-bromo-3,3-dimethyl-2-methylidenecyclohexan-1-one.
| Compound Name | (4R)-4-bromo-3,3-dimethyl-2-methylidenecyclohexan-1-one |
|---|---|
| PubChem CID | 132551745 |
| Molecular Formula | C9H13BrO |
| Molecular Weight | 217.11 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | (4R)-4-bromo-3,3-dimethyl-2-methylidenecyclohexan-1-one |
| SMILES | C=C1C(=O)CC[C@@H](Br)C1(C)C |
| InChI | InChI=1S/C9H13BrO/c1-6-7(11)4-5-8(10)9(6,2)3/h8H,1,4-5H2,2-3H3/t8-/m1/s1 |
| InChIKey | WUINZLFUXRQEQI-MRVPVSSYSA-N |
| XLogP | 2.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.11 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|