C16H27BrO — CID 101144714
(3S,3aS,7R,7aR)-7-bromo-3-[(1R)-1-methoxy-2-methylpropyl]-7a-methyl-4-methylidene-2,3,3a,5,6,7-hexahydro-1H-indene (PubChem CID 101144714) has the molecular formula C16H27BrO and a molecular weight of 315.30 g/mol. Its IUPAC name is (3S,3aS,7R,7aR)-7-bromo-3-[(1R)-1-methoxy-2-methylpropyl]-7a-methyl-4-methylidene-2,3,3a,5,6,7-hexahydro-1H-indene.
| Compound Name | (3S,3aS,7R,7aR)-7-bromo-3-[(1R)-1-methoxy-2-methylpropyl]-7a-methyl-4-methylidene-2,3,3a,5,6,7-hexahydro-1H-indene |
|---|---|
| PubChem CID | 101144714 |
| Molecular Formula | C16H27BrO |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | (3S,3aS,7R,7aR)-7-bromo-3-[(1R)-1-methoxy-2-methylpropyl]-7a-methyl-4-methylidene-2,3,3a,5,6,7-hexahydro-1H-indene |
| SMILES | C=C1CC[C@@H](Br)[C@]2(C)CC[C@H]([C@H](OC)C(C)C)[C@@H]12 |
| InChI | InChI=1S/C16H27BrO/c1-10(2)15(18-5)12-8-9-16(4)13(17)7-6-11(3)14(12)16/h10,12-15H,3,6-9H2,1-2,4-5H3/t12-,13+,14+,15+,16-/m0/s1 |
| InChIKey | UFSVFEPQLKIMHO-GCSSGZNBSA-N |
| XLogP | 4.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|