C13H20O2 — CID 15406232
(1R,2S,5R,7R)-10,10-dimethyl-4-methylidenetricyclo[5.2.1.01,5]decane-2,5-diol (PubChem CID 15406232) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is (1R,2S,5R,7R)-10,10-dimethyl-4-methylidenetricyclo[5.2.1.01,5]decane-2,5-diol.
| Compound Name | (1R,2S,5R,7R)-10,10-dimethyl-4-methylidenetricyclo[5.2.1.01,5]decane-2,5-diol |
|---|---|
| PubChem CID | 15406232 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | (1R,2S,5R,7R)-10,10-dimethyl-4-methylidenetricyclo[5.2.1.01,5]decane-2,5-diol |
| SMILES | C=C1C[C@H](O)[C@]23CC[C@H](C[C@@]12O)C3(C)C |
| InChI | InChI=1S/C13H20O2/c1-8-6-10(14)12-5-4-9(11(12,2)3)7-13(8,12)15/h9-10,14-15H,1,4-7H2,2-3H3/t9-,10+,12+,13-/m1/s1 |
| InChIKey | YNHLWWOJRNUFMO-RSLMWUCJSA-N |
| XLogP | 1.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|