C9H12Cl2O — CID 134987345
cis-(3R,4R)-4-chloro-3-[(E)-2-chloroethenyl]-3-methylcyclohexan-1-one (PubChem CID 134987345) has the molecular formula C9H12Cl2O and a molecular weight of 207.10 g/mol. Its IUPAC name is cis-(3R,4R)-4-chloro-3-[(E)-2-chloroethenyl]-3-methylcyclohexan-1-one.
| Compound Name | cis-(3R,4R)-4-chloro-3-[(E)-2-chloroethenyl]-3-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 134987345 |
| Molecular Formula | C9H12Cl2O |
| Molecular Weight | 207.10 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | cis-(3R,4R)-4-chloro-3-[(E)-2-chloroethenyl]-3-methylcyclohexan-1-one |
| SMILES | C[C@]1(/C=C/Cl)CC(=O)CC[C@H]1Cl |
| InChI | InChI=1S/C9H12Cl2O/c1-9(4-5-10)6-7(12)2-3-8(9)11/h4-5,8H,2-3,6H2,1H3/b5-4+/t8-,9+/m1/s1 |
| InChIKey | ZREKHHKETXPLOU-VJIGKBMESA-N |
| XLogP | 3.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.10 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|