About 4-tert-butyl-3,3-dimethylcyclohexan-1-one
4-tert-butyl-3,3-dimethylcyclohexan-1-one (PubChem CID 168743359) has the molecular formula C12H22O
and a molecular weight of 182.31 g/mol. Its IUPAC name is 4-tert-butyl-3,3-dimethylcyclohexan-1-one.
Molecular Properties
| Compound Name | 4-tert-butyl-3,3-dimethylcyclohexan-1-one |
| PubChem CID | 168743359 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | 4-tert-butyl-3,3-dimethylcyclohexan-1-one |
| SMILES | CC(C)(C)C1CCC(=O)CC1(C)C |
| InChI | InChI=1S/C12H22O/c1-11(2,3)10-7-6-9(13)8-12(10,4)5/h10H,6-8H2,1-5H3 |
| InChIKey | QMJKSEJGAPZBCO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-tert-butyl-3,3-dimethylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-3,3-dimethylcyclohexan-1-one?
The IUPAC name of 4-tert-butyl-3,3-dimethylcyclohexan-1-one (CID 168743359) is 4-tert-butyl-3,3-dimethylcyclohexan-1-one.
What is the SMILES notation for 4-tert-butyl-3,3-dimethylcyclohexan-1-one?
The canonical SMILES for 4-tert-butyl-3,3-dimethylcyclohexan-1-one is CC(C)(C)C1CCC(=O)CC1(C)C.
What is the InChIKey of 4-tert-butyl-3,3-dimethylcyclohexan-1-one?
The InChIKey is QMJKSEJGAPZBCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O/c1-11(2,3)10-7-6-9(13)8-12(10,4)5/h10H,6-8H2,1-5H3.
What are the key properties of 4-tert-butyl-3,3-dimethylcyclohexan-1-one?
4-tert-butyl-3,3-dimethylcyclohexan-1-one has a molecular weight of 182.31 g/mol, XLogP of 3.43, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-3,3-dimethylcyclohexan-1-one is sourced from PubChem (CID 168743359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).