C16H26O2 — CID 10490928
2-(4-tert-butylcyclohexylidene)-5,5-dimethyloxolan-3-one (PubChem CID 10490928) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 2-(4-tert-butylcyclohexylidene)-5,5-dimethyloxolan-3-one.
| Compound Name | 2-(4-tert-butylcyclohexylidene)-5,5-dimethyloxolan-3-one |
|---|---|
| PubChem CID | 10490928 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 2-(4-tert-butylcyclohexylidene)-5,5-dimethyloxolan-3-one |
| SMILES | CC1(C)CC(=O)C(=C2CCC(C(C)(C)C)CC2)O1 |
| InChI | InChI=1S/C16H26O2/c1-15(2,3)12-8-6-11(7-9-12)14-13(17)10-16(4,5)18-14/h12H,6-10H2,1-5H3/b14-11- |
| InChIKey | RMDFERZKVOTGCP-KAMYIIQDSA-N |
| XLogP | 4.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|