C19H26Cl2O3 — CID 24870134
7-[(2,4-dichlorocyclohexyl)methoxy]-2,2,8-trimethyl-5,6-dihydro-3H-chromen-4-one (PubChem CID 24870134) has the molecular formula C19H26Cl2O3 and a molecular weight of 373.32 g/mol. Its IUPAC name is 7-[(2,4-dichlorocyclohexyl)methoxy]-2,2,8-trimethyl-5,6-dihydro-3H-chromen-4-one.
| Compound Name | 7-[(2,4-dichlorocyclohexyl)methoxy]-2,2,8-trimethyl-5,6-dihydro-3H-chromen-4-one |
|---|---|
| PubChem CID | 24870134 |
| Molecular Formula | C19H26Cl2O3 |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 7-[(2,4-dichlorocyclohexyl)methoxy]-2,2,8-trimethyl-5,6-dihydro-3H-chromen-4-one |
| SMILES | CC1=C(OCC2CCC(Cl)CC2Cl)CCC2=C1OC(C)(C)CC2=O |
| InChI | InChI=1S/C19H26Cl2O3/c1-11-17(23-10-12-4-5-13(20)8-15(12)21)7-6-14-16(22)9-19(2,3)24-18(11)14/h12-13,15H,4-10H2,1-3H3 |
| InChIKey | NJAPIYKHGSVHDF-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|