About 7-chloro-2,2-dimethyl-3H-pyrano[3,2-c]pyridin-4-one
7-chloro-2,2-dimethyl-3H-pyrano[3,2-c]pyridin-4-one (PubChem CID 88921692) has the molecular formula C10H10ClNO2
and a molecular weight of 211.65 g/mol. Its IUPAC name is 7-chloro-2,2-dimethyl-3H-pyrano[3,2-c]pyridin-4-one.
Molecular Properties
| Compound Name | 7-chloro-2,2-dimethyl-3H-pyrano[3,2-c]pyridin-4-one |
| PubChem CID | 88921692 |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 7-chloro-2,2-dimethyl-3H-pyrano[3,2-c]pyridin-4-one |
| SMILES | CC1(C)CC(=O)c2cnc(Cl)cc2O1 |
| InChI | InChI=1S/C10H10ClNO2/c1-10(2)4-7(13)6-5-12-9(11)3-8(6)14-10/h3,5H,4H2,1-2H3 |
| InChIKey | WHOBYIKRQFJJDL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-2,2-dimethyl-3H-pyrano[3,2-c]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2,2-dimethyl-3H-pyrano[3,2-c]pyridin-4-one?
The IUPAC name of 7-chloro-2,2-dimethyl-3H-pyrano[3,2-c]pyridin-4-one (CID 88921692) is 7-chloro-2,2-dimethyl-3H-pyrano[3,2-c]pyridin-4-one.
What is the SMILES notation for 7-chloro-2,2-dimethyl-3H-pyrano[3,2-c]pyridin-4-one?
The canonical SMILES for 7-chloro-2,2-dimethyl-3H-pyrano[3,2-c]pyridin-4-one is CC1(C)CC(=O)c2cnc(Cl)cc2O1.
What is the InChIKey of 7-chloro-2,2-dimethyl-3H-pyrano[3,2-c]pyridin-4-one?
The InChIKey is WHOBYIKRQFJJDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClNO2/c1-10(2)4-7(13)6-5-12-9(11)3-8(6)14-10/h3,5H,4H2,1-2H3.
What are the key properties of 7-chloro-2,2-dimethyl-3H-pyrano[3,2-c]pyridin-4-one?
7-chloro-2,2-dimethyl-3H-pyrano[3,2-c]pyridin-4-one has a molecular weight of 211.65 g/mol, XLogP of 2.48, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2,2-dimethyl-3H-pyrano[3,2-c]pyridin-4-one is sourced from PubChem (CID 88921692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).