C15H18O5 — CID 2728596
ethyl 2-[(2,2-dimethyl-4-oxo-3H-chromen-7-yl)oxy]acetate (PubChem CID 2728596) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is ethyl 2-[(2,2-dimethyl-4-oxo-3H-chromen-7-yl)oxy]acetate.
| Compound Name | ethyl 2-[(2,2-dimethyl-4-oxo-3H-chromen-7-yl)oxy]acetate |
|---|---|
| PubChem CID | 2728596 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | ethyl 2-[(2,2-dimethyl-4-oxo-3H-chromen-7-yl)oxy]acetate |
| SMILES | CCOC(=O)COc1ccc2c(c1)OC(C)(C)CC2=O |
| InChI | InChI=1S/C15H18O5/c1-4-18-14(17)9-19-10-5-6-11-12(16)8-15(2,3)20-13(11)7-10/h5-7H,4,8-9H2,1-3H3 |
| InChIKey | ZJIDRLNCCWGBFS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |