C18H17BrO3 — CID 127042315
7-[(3-bromophenyl)methoxy]-2,2-dimethyl-3H-chromen-4-one (PubChem CID 127042315) has the molecular formula C18H17BrO3 and a molecular weight of 361.24 g/mol. Its IUPAC name is 7-[(3-bromophenyl)methoxy]-2,2-dimethyl-3H-chromen-4-one.
| Compound Name | 7-[(3-bromophenyl)methoxy]-2,2-dimethyl-3H-chromen-4-one |
|---|---|
| PubChem CID | 127042315 |
| Molecular Formula | C18H17BrO3 |
| Molecular Weight | 361.24 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 7-[(3-bromophenyl)methoxy]-2,2-dimethyl-3H-chromen-4-one |
| SMILES | CC1(C)CC(=O)c2ccc(OCc3cccc(Br)c3)cc2O1 |
| InChI | InChI=1S/C18H17BrO3/c1-18(2)10-16(20)15-7-6-14(9-17(15)22-18)21-11-12-4-3-5-13(19)8-12/h3-9H,10-11H2,1-2H3 |
| InChIKey | KNFKGWFFUWDXON-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.24 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |