C9H14O3 — CID 90777328
2-hydroxy-2-methylcyclooctane-1,4-dione (PubChem CID 90777328) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-hydroxy-2-methylcyclooctane-1,4-dione.
| Compound Name | 2-hydroxy-2-methylcyclooctane-1,4-dione |
|---|---|
| PubChem CID | 90777328 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 2-hydroxy-2-methylcyclooctane-1,4-dione |
| SMILES | CC1(O)CC(=O)CCCCC1=O |
| InChI | InChI=1S/C9H14O3/c1-9(12)6-7(10)4-2-3-5-8(9)11/h12H,2-6H2,1H3 |
| InChIKey | IJRIAEPGPFVIAT-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |