C14H17NO2 — CID 138635101
(4aR,8aS)-4,4,8a-trimethyl-3,7-dioxo-4a,5,6,8-tetrahydronaphthalene-2-carbonitrile (PubChem CID 138635101) has the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. Its IUPAC name is (4aR,8aS)-4,4,8a-trimethyl-3,7-dioxo-4a,5,6,8-tetrahydronaphthalene-2-carbonitrile.
| Compound Name | (4aR,8aS)-4,4,8a-trimethyl-3,7-dioxo-4a,5,6,8-tetrahydronaphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 138635101 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | (4aR,8aS)-4,4,8a-trimethyl-3,7-dioxo-4a,5,6,8-tetrahydronaphthalene-2-carbonitrile |
| SMILES | CC1(C)C(=O)C(C#N)=C[C@]2(C)CC(=O)CC[C@@H]12 |
| InChI | InChI=1S/C14H17NO2/c1-13(2)11-5-4-10(16)7-14(11,3)6-9(8-15)12(13)17/h6,11H,4-5,7H2,1-3H3/t11-,14+/m0/s1 |
| InChIKey | VUNJDFMGSBIRFH-SMDDNHRTSA-N |
| XLogP | 2.42 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |