C19H22N2O3S — CID 146237007
(4aS,8aR)-2-(benzenesulfonyl)-5,5,8a-trimethyl-6-oxo-1,3,4,4a-tetrahydroisoquinoline-7-carbonitrile (PubChem CID 146237007) has the molecular formula C19H22N2O3S and a molecular weight of 358.46 g/mol. Its IUPAC name is (4aS,8aR)-2-(benzenesulfonyl)-5,5,8a-trimethyl-6-oxo-1,3,4,4a-tetrahydroisoquinoline-7-carbonitrile.
| Compound Name | (4aS,8aR)-2-(benzenesulfonyl)-5,5,8a-trimethyl-6-oxo-1,3,4,4a-tetrahydroisoquinoline-7-carbonitrile |
|---|---|
| PubChem CID | 146237007 |
| Molecular Formula | C19H22N2O3S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | (4aS,8aR)-2-(benzenesulfonyl)-5,5,8a-trimethyl-6-oxo-1,3,4,4a-tetrahydroisoquinoline-7-carbonitrile |
| SMILES | CC1(C)C(=O)C(C#N)=C[C@@]2(C)CN(S(=O)(=O)c3ccccc3)CC[C@H]12 |
| InChI | InChI=1S/C19H22N2O3S/c1-18(2)16-9-10-21(25(23,24)15-7-5-4-6-8-15)13-19(16,3)11-14(12-20)17(18)22/h4-8,11,16H,9-10,13H2,1-3H3/t16-,19+/m1/s1 |
| InChIKey | KKGAZBGFJLPOFJ-APWZRJJASA-N |
| XLogP | 2.76 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |