About 4-(2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-yl)sulfonylbenzonitrile
4-(2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-yl)sulfonylbenzonitrile (PubChem CID 53176982) has the molecular formula C18H15N3O3S
and a molecular weight of 353.40 g/mol. Its IUPAC name is 4-(2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-yl)sulfonylbenzonitrile.
Molecular Properties
| Compound Name | 4-(2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-yl)sulfonylbenzonitrile |
| PubChem CID | 53176982 |
| Molecular Formula | C18H15N3O3S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 4-(2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-yl)sulfonylbenzonitrile |
| SMILES | N#Cc1ccc(S(=O)(=O)N2CCC3(C2)C(=O)Nc2ccccc23)cc1 |
| InChI | InChI=1S/C18H15N3O3S/c19-11-13-5-7-14(8-6-13)25(23,24)21-10-9-18(12-21)15-3-1-2-4-16(15)20-17(18)22/h1-8H,9-10,12H2,(H,20,22) |
| InChIKey | RHKBVKMVMAQTMY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-yl)sulfonylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-yl)sulfonylbenzonitrile?
The IUPAC name of 4-(2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-yl)sulfonylbenzonitrile (CID 53176982) is 4-(2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-yl)sulfonylbenzonitrile.
What is the SMILES notation for 4-(2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-yl)sulfonylbenzonitrile?
The canonical SMILES for 4-(2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-yl)sulfonylbenzonitrile is N#Cc1ccc(S(=O)(=O)N2CCC3(C2)C(=O)Nc2ccccc23)cc1.
What is the InChIKey of 4-(2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-yl)sulfonylbenzonitrile?
The InChIKey is RHKBVKMVMAQTMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3O3S/c19-11-13-5-7-14(8-6-13)25(23,24)21-10-9-18(12-21)15-3-1-2-4-16(15)20-17(18)22/h1-8H,9-10,12H2,(H,20,22).
What are the key properties of 4-(2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-yl)sulfonylbenzonitrile?
4-(2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-yl)sulfonylbenzonitrile has a molecular weight of 353.40 g/mol, XLogP of 1.84, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-oxospiro[1H-indole-3,3'-pyrrolidine]-1'-yl)sulfonylbenzonitrile is sourced from PubChem (CID 53176982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).