C19H22N2O2 — CID 138660422
(4aR,7S,8aS)-7-hydroxy-4,4,8a-trimethyl-3-oxo-7-pyridin-3-yl-4a,5,6,8-tetrahydronaphthalene-2-carbonitrile (PubChem CID 138660422) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is (4aR,7S,8aS)-7-hydroxy-4,4,8a-trimethyl-3-oxo-7-pyridin-3-yl-4a,5,6,8-tetrahydronaphthalene-2-carbonitrile.
| Compound Name | (4aR,7S,8aS)-7-hydroxy-4,4,8a-trimethyl-3-oxo-7-pyridin-3-yl-4a,5,6,8-tetrahydronaphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 138660422 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (4aR,7S,8aS)-7-hydroxy-4,4,8a-trimethyl-3-oxo-7-pyridin-3-yl-4a,5,6,8-tetrahydronaphthalene-2-carbonitrile |
| SMILES | CC1(C)C(=O)C(C#N)=C[C@]2(C)C[C@](O)(c3cccnc3)CC[C@@H]12 |
| InChI | InChI=1S/C19H22N2O2/c1-17(2)15-6-7-19(23,14-5-4-8-21-11-14)12-18(15,3)9-13(10-20)16(17)22/h4-5,8-9,11,15,23H,6-7,12H2,1-3H3/t15-,18+,19-/m0/s1 |
| InChIKey | CAFKXKGGHPMIMY-IPELMVKDSA-N |
| XLogP | 3.13 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |