C14H19NO2 — CID 138660907
(4aR,7R,8aS)-7-hydroxy-4,4,8a-trimethyl-3-oxo-5,6,7,8-tetrahydro-4aH-naphthalene-2-carbonitrile (PubChem CID 138660907) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is (4aR,7R,8aS)-7-hydroxy-4,4,8a-trimethyl-3-oxo-5,6,7,8-tetrahydro-4aH-naphthalene-2-carbonitrile.
| Compound Name | (4aR,7R,8aS)-7-hydroxy-4,4,8a-trimethyl-3-oxo-5,6,7,8-tetrahydro-4aH-naphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 138660907 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (4aR,7R,8aS)-7-hydroxy-4,4,8a-trimethyl-3-oxo-5,6,7,8-tetrahydro-4aH-naphthalene-2-carbonitrile |
| SMILES | CC1(C)C(=O)C(C#N)=C[C@]2(C)C[C@H](O)CC[C@@H]12 |
| InChI | InChI=1S/C14H19NO2/c1-13(2)11-5-4-10(16)7-14(11,3)6-9(8-15)12(13)17/h6,10-11,16H,4-5,7H2,1-3H3/t10-,11+,14-/m1/s1 |
| InChIKey | KQAMURZIXUIAEQ-UHIISALHSA-N |
| XLogP | 2.21 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |