C18H20N4O2 — CID 146237042
(4aS,8aR)-5,5,8a-trimethyl-6-oxo-2-(pyrimidine-5-carbonyl)-1,3,4,4a-tetrahydroisoquinoline-7-carbonitrile (PubChem CID 146237042) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is (4aS,8aR)-5,5,8a-trimethyl-6-oxo-2-(pyrimidine-5-carbonyl)-1,3,4,4a-tetrahydroisoquinoline-7-carbonitrile.
| Compound Name | (4aS,8aR)-5,5,8a-trimethyl-6-oxo-2-(pyrimidine-5-carbonyl)-1,3,4,4a-tetrahydroisoquinoline-7-carbonitrile |
|---|---|
| PubChem CID | 146237042 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | (4aS,8aR)-5,5,8a-trimethyl-6-oxo-2-(pyrimidine-5-carbonyl)-1,3,4,4a-tetrahydroisoquinoline-7-carbonitrile |
| SMILES | CC1(C)C(=O)C(C#N)=C[C@@]2(C)CN(C(=O)c3cncnc3)CC[C@H]12 |
| InChI | InChI=1S/C18H20N4O2/c1-17(2)14-4-5-22(16(24)13-8-20-11-21-9-13)10-18(14,3)6-12(7-19)15(17)23/h6,8-9,11,14H,4-5,10H2,1-3H3/t14-,18+/m1/s1 |
| InChIKey | FSHNHJAQEGEUBY-KDOFPFPSSA-N |
| XLogP | 2.00 |
| TPSA | 86.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |