C21H25NO2 — CID 155139382
(4aS,7S,8aR)-7-benzyl-7-hydroxy-4,4,8a-trimethyl-3-oxo-4a,5,6,8-tetrahydronaphthalene-2-carbonitrile (PubChem CID 155139382) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is (4aS,7S,8aR)-7-benzyl-7-hydroxy-4,4,8a-trimethyl-3-oxo-4a,5,6,8-tetrahydronaphthalene-2-carbonitrile.
| Compound Name | (4aS,7S,8aR)-7-benzyl-7-hydroxy-4,4,8a-trimethyl-3-oxo-4a,5,6,8-tetrahydronaphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 155139382 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | (4aS,7S,8aR)-7-benzyl-7-hydroxy-4,4,8a-trimethyl-3-oxo-4a,5,6,8-tetrahydronaphthalene-2-carbonitrile |
| SMILES | CC1(C)C(=O)C(C#N)=C[C@@]2(C)C[C@@](O)(Cc3ccccc3)CC[C@H]12 |
| InChI | InChI=1S/C21H25NO2/c1-19(2)17-9-10-21(24,11-15-7-5-4-6-8-15)14-20(17,3)12-16(13-22)18(19)23/h4-8,12,17,24H,9-11,14H2,1-3H3/t17-,20+,21+/m1/s1 |
| InChIKey | QMQPULNGBCLFOC-QMMLZNLJSA-N |
| XLogP | 3.83 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |