C17H24N2O2 — CID 138660433
N-[(2R,4aS,8aR)-7-cyano-5,5,8a-trimethyl-6-oxo-2,3,4,4a-tetrahydro-1H-naphthalen-2-yl]-N-methylacetamide (PubChem CID 138660433) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is N-[(2R,4aS,8aR)-7-cyano-5,5,8a-trimethyl-6-oxo-2,3,4,4a-tetrahydro-1H-naphthalen-2-yl]-N-methylacetamide.
| Compound Name | N-[(2R,4aS,8aR)-7-cyano-5,5,8a-trimethyl-6-oxo-2,3,4,4a-tetrahydro-1H-naphthalen-2-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 138660433 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | N-[(2R,4aS,8aR)-7-cyano-5,5,8a-trimethyl-6-oxo-2,3,4,4a-tetrahydro-1H-naphthalen-2-yl]-N-methylacetamide |
| SMILES | CC(=O)N(C)[C@@H]1CC[C@@H]2C(C)(C)C(=O)C(C#N)=C[C@@]2(C)C1 |
| InChI | InChI=1S/C17H24N2O2/c1-11(20)19(5)13-6-7-14-16(2,3)15(21)12(10-18)8-17(14,4)9-13/h8,13-14H,6-7,9H2,1-5H3/t13-,14-,17+/m1/s1 |
| InChIKey | STZDBVVEXDJMTH-CPUCHLNUSA-N |
| XLogP | 2.70 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |