C10H14Cl4 — CID 14193705
(1R,2S,4S,5R)-1,2,4-trichloro-5-[(E)-2-chloroethenyl]-1,5-dimethylcyclohexane (PubChem CID 14193705) has the molecular formula C10H14Cl4 and a molecular weight of 276.03 g/mol. Its IUPAC name is (1R,2S,4S,5R)-1,2,4-trichloro-5-[(E)-2-chloroethenyl]-1,5-dimethylcyclohexane.
| Compound Name | (1R,2S,4S,5R)-1,2,4-trichloro-5-[(E)-2-chloroethenyl]-1,5-dimethylcyclohexane |
|---|---|
| PubChem CID | 14193705 |
| Molecular Formula | C10H14Cl4 |
| Molecular Weight | 276.03 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | (1R,2S,4S,5R)-1,2,4-trichloro-5-[(E)-2-chloroethenyl]-1,5-dimethylcyclohexane |
| SMILES | C[C@]1(/C=C/Cl)C[C@@](C)(Cl)[C@@H](Cl)C[C@@H]1Cl |
| InChI | InChI=1S/C10H14Cl4/c1-9(3-4-11)6-10(2,14)8(13)5-7(9)12/h3-4,7-8H,5-6H2,1-2H3/b4-3+/t7-,8-,9-,10+/m0/s1 |
| InChIKey | UIRLQTKDEMKKKG-WBSNBJSJSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.03 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|