About 5-bromo-3-chloro-2-(1-chloroethenyl)-2,6,6-trimethyloxane
5-bromo-3-chloro-2-(1-chloroethenyl)-2,6,6-trimethyloxane (PubChem CID 163064299) has the molecular formula C10H15BrCl2O
and a molecular weight of 302.04 g/mol. Its IUPAC name is 5-bromo-3-chloro-2-(1-chloroethenyl)-2,6,6-trimethyloxane.
Molecular Properties
| Compound Name | 5-bromo-3-chloro-2-(1-chloroethenyl)-2,6,6-trimethyloxane |
| PubChem CID | 163064299 |
| Molecular Formula | C10H15BrCl2O |
| Molecular Weight | 302.04 g/mol |
| Exact Mass | 299.97 |
| IUPAC Name | 5-bromo-3-chloro-2-(1-chloroethenyl)-2,6,6-trimethyloxane |
| SMILES | C=C(Cl)C1(C)OC(C)(C)C(Br)CC1Cl |
| InChI | InChI=1S/C10H15BrCl2O/c1-6(12)10(4)8(13)5-7(11)9(2,3)14-10/h7-8H,1,5H2,2-4H3 |
| InChIKey | JIYDPDVHIGOLQZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.04 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-3-chloro-2-(1-chloroethenyl)-2,6,6-trimethyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-chloro-2-(1-chloroethenyl)-2,6,6-trimethyloxane?
The IUPAC name of 5-bromo-3-chloro-2-(1-chloroethenyl)-2,6,6-trimethyloxane (CID 163064299) is 5-bromo-3-chloro-2-(1-chloroethenyl)-2,6,6-trimethyloxane.
What is the SMILES notation for 5-bromo-3-chloro-2-(1-chloroethenyl)-2,6,6-trimethyloxane?
The canonical SMILES for 5-bromo-3-chloro-2-(1-chloroethenyl)-2,6,6-trimethyloxane is C=C(Cl)C1(C)OC(C)(C)C(Br)CC1Cl.
What is the InChIKey of 5-bromo-3-chloro-2-(1-chloroethenyl)-2,6,6-trimethyloxane?
The InChIKey is JIYDPDVHIGOLQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15BrCl2O/c1-6(12)10(4)8(13)5-7(11)9(2,3)14-10/h7-8H,1,5H2,2-4H3.
What are the key properties of 5-bromo-3-chloro-2-(1-chloroethenyl)-2,6,6-trimethyloxane?
5-bromo-3-chloro-2-(1-chloroethenyl)-2,6,6-trimethyloxane has a molecular weight of 302.04 g/mol, XLogP of 4.07, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-chloro-2-(1-chloroethenyl)-2,6,6-trimethyloxane is sourced from PubChem (CID 163064299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).