C10H13BrO2 — CID 101222982
(1R,4R,6R)-4-(3-bromoprop-1-en-2-yl)-1-methyl-7-oxabicyclo[4.1.0]heptan-2-one (PubChem CID 101222982) has the molecular formula C10H13BrO2 and a molecular weight of 245.12 g/mol. Its IUPAC name is (1R,4R,6R)-4-(3-bromoprop-1-en-2-yl)-1-methyl-7-oxabicyclo[4.1.0]heptan-2-one.
| Compound Name | (1R,4R,6R)-4-(3-bromoprop-1-en-2-yl)-1-methyl-7-oxabicyclo[4.1.0]heptan-2-one |
|---|---|
| PubChem CID | 101222982 |
| Molecular Formula | C10H13BrO2 |
| Molecular Weight | 245.12 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | (1R,4R,6R)-4-(3-bromoprop-1-en-2-yl)-1-methyl-7-oxabicyclo[4.1.0]heptan-2-one |
| SMILES | C=C(CBr)[C@H]1CC(=O)[C@]2(C)O[C@@H]2C1 |
| InChI | InChI=1S/C10H13BrO2/c1-6(5-11)7-3-8(12)10(2)9(4-7)13-10/h7,9H,1,3-5H2,2H3/t7-,9+,10-/m0/s1 |
| InChIKey | DZUXHCKNGVSWAN-SFGNSQDASA-N |
| XLogP | 2.07 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.12 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|