C10H16O5 — CID 59968762
(4S)-4-(1-hydroperoxy-1-methoxyethyl)-1-methyl-7-oxabicyclo[4.1.0]heptan-2-one (PubChem CID 59968762) has the molecular formula C10H16O5 and a molecular weight of 216.23 g/mol. Its IUPAC name is (4S)-4-(1-hydroperoxy-1-methoxyethyl)-1-methyl-7-oxabicyclo[4.1.0]heptan-2-one.
| Compound Name | (4S)-4-(1-hydroperoxy-1-methoxyethyl)-1-methyl-7-oxabicyclo[4.1.0]heptan-2-one |
|---|---|
| PubChem CID | 59968762 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | (4S)-4-(1-hydroperoxy-1-methoxyethyl)-1-methyl-7-oxabicyclo[4.1.0]heptan-2-one |
| SMILES | COC(C)(OO)[C@@H]1CC(=O)C2(C)OC2C1 |
| InChI | InChI=1S/C10H16O5/c1-9-7(11)4-6(5-8(9)14-9)10(2,13-3)15-12/h6,8,12H,4-5H2,1-3H3/t6-,8?,9?,10?/m1/s1 |
| InChIKey | PSYCZAMZSOLIOP-ICJLCFDTSA-N |
| XLogP | 0.98 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|