C20H26O8 — CID 163026524
[4-[2-(4-hydroperoxy-4-methylpent-2-enoyl)oxiran-2-yl]-1-methyl-2-oxo-7-oxabicyclo[4.1.0]heptan-3-yl] 2-methylbut-2-enoate (PubChem CID 163026524) has the molecular formula C20H26O8 and a molecular weight of 394.42 g/mol. Its IUPAC name is [4-[2-(4-hydroperoxy-4-methylpent-2-enoyl)oxiran-2-yl]-1-methyl-2-oxo-7-oxabicyclo[4.1.0]heptan-3-yl] 2-methylbut-2-enoate.
| Compound Name | [4-[2-(4-hydroperoxy-4-methylpent-2-enoyl)oxiran-2-yl]-1-methyl-2-oxo-7-oxabicyclo[4.1.0]heptan-3-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 163026524 |
| Molecular Formula | C20H26O8 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | [4-[2-(4-hydroperoxy-4-methylpent-2-enoyl)oxiran-2-yl]-1-methyl-2-oxo-7-oxabicyclo[4.1.0]heptan-3-yl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1C(=O)C2(C)OC2CC1C1(C(=O)C=CC(C)(C)OO)CO1 |
| InChI | InChI=1S/C20H26O8/c1-6-11(2)17(23)26-15-12(9-14-19(5,27-14)16(15)22)20(10-25-20)13(21)7-8-18(3,4)28-24/h6-8,12,14-15,24H,9-10H2,1-5H3 |
| InChIKey | FFSZFSPHSRVERO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 114.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|