C20H28O5 — CID 163005365
[1-methyl-4-(6-methyl-3-oxohepta-1,5-dien-2-yl)-2-oxo-7-oxabicyclo[4.1.0]heptan-3-yl] 3-methylbutanoate (PubChem CID 163005365) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is [1-methyl-4-(6-methyl-3-oxohepta-1,5-dien-2-yl)-2-oxo-7-oxabicyclo[4.1.0]heptan-3-yl] 3-methylbutanoate.
| Compound Name | [1-methyl-4-(6-methyl-3-oxohepta-1,5-dien-2-yl)-2-oxo-7-oxabicyclo[4.1.0]heptan-3-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 163005365 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | [1-methyl-4-(6-methyl-3-oxohepta-1,5-dien-2-yl)-2-oxo-7-oxabicyclo[4.1.0]heptan-3-yl] 3-methylbutanoate |
| SMILES | C=C(C(=O)CC=C(C)C)C1CC2OC2(C)C(=O)C1OC(=O)CC(C)C |
| InChI | InChI=1S/C20H28O5/c1-11(2)7-8-15(21)13(5)14-10-16-20(6,25-16)19(23)18(14)24-17(22)9-12(3)4/h7,12,14,16,18H,5,8-10H2,1-4,6H3 |
| InChIKey | WRTBQRDYSKVOOV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 72.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|