C20H28O7 — CID 162886067
(3,14-dihydroxy-4,8-dimethyl-12-methylidene-11-oxo-10,13-dioxatricyclo[6.4.2.01,9]tetradec-4-en-2-yl) 3-methylbutanoate (PubChem CID 162886067) has the molecular formula C20H28O7 and a molecular weight of 380.44 g/mol. Its IUPAC name is (3,14-dihydroxy-4,8-dimethyl-12-methylidene-11-oxo-10,13-dioxatricyclo[6.4.2.01,9]tetradec-4-en-2-yl) 3-methylbutanoate.
| Compound Name | (3,14-dihydroxy-4,8-dimethyl-12-methylidene-11-oxo-10,13-dioxatricyclo[6.4.2.01,9]tetradec-4-en-2-yl) 3-methylbutanoate |
|---|---|
| PubChem CID | 162886067 |
| Molecular Formula | C20H28O7 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (3,14-dihydroxy-4,8-dimethyl-12-methylidene-11-oxo-10,13-dioxatricyclo[6.4.2.01,9]tetradec-4-en-2-yl) 3-methylbutanoate |
| SMILES | C=C1C(=O)OC2C3(C)CCC=C(C)C(O)C(OC(=O)CC(C)C)C12OC3O |
| InChI | InChI=1S/C20H28O7/c1-10(2)9-13(21)25-15-14(22)11(3)7-6-8-19(5)17-20(15,27-18(19)24)12(4)16(23)26-17/h7,10,14-15,17-18,22,24H,4,6,8-9H2,1-3,5H3 |
| InChIKey | RDFXQRBXARYXLO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|