C20H26O8 — CID 162979512
[(1R,2R,3R,4E,8R,9R,14S)-3,14-dihydroxy-4,8-dimethyl-12-methylidene-11-oxo-10,13-dioxatricyclo[6.4.2.01,9]tetradec-4-en-2-yl] (2S,3R)-2,3-dimethyloxirane-2-carboxylate (PubChem CID 162979512) has the molecular formula C20H26O8 and a molecular weight of 394.42 g/mol. Its IUPAC name is [(1R,2R,3R,4E,8R,9R,14S)-3,14-dihydroxy-4,8-dimethyl-12-methylidene-11-oxo-10,13-dioxatricyclo[6.4.2.01,9]tetradec-4-en-2-yl] (2S,3R)-2,3-dimethyloxirane-2-carboxylate.
| Compound Name | [(1R,2R,3R,4E,8R,9R,14S)-3,14-dihydroxy-4,8-dimethyl-12-methylidene-11-oxo-10,13-dioxatricyclo[6.4.2.01,9]tetradec-4-en-2-yl] (2S,3R)-2,3-dimethyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 162979512 |
| Molecular Formula | C20H26O8 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | [(1R,2R,3R,4E,8R,9R,14S)-3,14-dihydroxy-4,8-dimethyl-12-methylidene-11-oxo-10,13-dioxatricyclo[6.4.2.01,9]tetradec-4-en-2-yl] (2S,3R)-2,3-dimethyloxirane-2-carboxylate |
| SMILES | C=C1C(=O)O[C@@H]2[C@@]3(C)CC/C=C(/C)[C@@H](O)[C@@H](OC(=O)[C@@]4(C)O[C@@H]4C)[C@@]12O[C@@H]3O |
| InChI | InChI=1S/C20H26O8/c1-9-7-6-8-18(4)15-20(28-16(18)23,10(2)14(22)26-15)13(12(9)21)25-17(24)19(5)11(3)27-19/h7,11-13,15-16,21,23H,2,6,8H2,1,3-5H3/b9-7-/t11-,12-,13-,15-,16+,18-,19+,20+/m1/s1 |
| InChIKey | WFLSXZQWWJXMLO-UPFXVFGQSA-N |
| XLogP | 0.75 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|