C21H28O6 — CID 162819789
(4,8-dimethyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-9-yl) 2-(2,3-dimethyloxiran-2-yl)acetate (PubChem CID 162819789) has the molecular formula C21H28O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is (4,8-dimethyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-9-yl) 2-(2,3-dimethyloxiran-2-yl)acetate.
| Compound Name | (4,8-dimethyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-9-yl) 2-(2,3-dimethyloxiran-2-yl)acetate |
|---|---|
| PubChem CID | 162819789 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | (4,8-dimethyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-9-yl) 2-(2,3-dimethyloxiran-2-yl)acetate |
| SMILES | C=C1C(=O)OC2C1CC(OC(=O)CC1(C)OC1C)C(C)=CCCC1(C)OC21 |
| InChI | InChI=1S/C21H28O6/c1-11-7-6-8-20(4)18(27-20)17-14(12(2)19(23)25-17)9-15(11)24-16(22)10-21(5)13(3)26-21/h7,13-15,17-18H,2,6,8-10H2,1,3-5H3 |
| InChIKey | WQJHDMOHRMVSTC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 77.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|