C21H30O6 — CID 22297156
[(1R,2R,4S,7E,9R,11S)-4,8-dimethyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-9-yl] 3-hydroxy-3-methylpentanoate (PubChem CID 22297156) has the molecular formula C21H30O6 and a molecular weight of 378.47 g/mol. Its IUPAC name is [(1R,2R,4S,7E,9R,11S)-4,8-dimethyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-9-yl] 3-hydroxy-3-methylpentanoate.
| Compound Name | [(1R,2R,4S,7E,9R,11S)-4,8-dimethyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-9-yl] 3-hydroxy-3-methylpentanoate |
|---|---|
| PubChem CID | 22297156 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | [(1R,2R,4S,7E,9R,11S)-4,8-dimethyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-9-yl] 3-hydroxy-3-methylpentanoate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]3O[C@@]3(C)CC/C=C(\C)[C@H](OC(=O)CC(C)(O)CC)C[C@@H]12 |
| InChI | InChI=1S/C21H30O6/c1-6-20(4,24)11-16(22)25-15-10-14-13(3)19(23)26-17(14)18-21(5,27-18)9-7-8-12(15)2/h8,14-15,17-18,24H,3,6-7,9-11H2,1-2,4-5H3/b12-8+/t14-,15+,17+,18+,20?,21-/m0/s1 |
| InChIKey | NXPRFOOHJTWPQI-UQDPOFOMSA-N |
| XLogP | 2.83 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|